C58H60O4 — CID 102083462
(2E,3R)-3-hydroxy-2-[(1R)-1-hydroxy-1-[4-(4-octylphenyl)phenyl]-3-oxoinden-2-ylidene]-3-[4-(4-octylphenyl)phenyl]inden-1-one (PubChem CID 102083462) has the molecular formula C58H60O4 and a molecular weight of 821.11 g/mol. Its IUPAC name is (2E,3R)-3-hydroxy-2-[(1R)-1-hydroxy-1-[4-(4-octylphenyl)phenyl]-3-oxoinden-2-ylidene]-3-[4-(4-octylphenyl)phenyl]inden-1-one.
| Compound Name | (2E,3R)-3-hydroxy-2-[(1R)-1-hydroxy-1-[4-(4-octylphenyl)phenyl]-3-oxoinden-2-ylidene]-3-[4-(4-octylphenyl)phenyl]inden-1-one |
|---|---|
| PubChem CID | 102083462 |
| Molecular Formula | C58H60O4 |
| Molecular Weight | 821.11 g/mol |
| Exact Mass | 820.45 |
| IUPAC Name | (2E,3R)-3-hydroxy-2-[(1R)-1-hydroxy-1-[4-(4-octylphenyl)phenyl]-3-oxoinden-2-ylidene]-3-[4-(4-octylphenyl)phenyl]inden-1-one |
| SMILES | CCCCCCCCc1ccc(-c2ccc([C@]3(O)/C(=C4\C(=O)c5ccccc5[C@]4(O)c4ccc(-c5ccc(CCCCCCCC)cc5)cc4)C(=O)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C58H60O4/c1-3-5-7-9-11-13-19-41-25-29-43(30-26-41)45-33-37-47(38-34-45)57(61)51-23-17-15-21-49(51)55(59)53(57)54-56(60)50-22-16-18-24-52(50)58(54,62)48-39-35-46(36-40-48)44-31-27-42(28-32-44)20-14-12-10-8-6-4-2/h15-18,21-40,61-62H,3-14,19-20H2,1-2H3/b54-53+/t57-,58-/m1/s1 |
| InChIKey | YZNJQRXMVCPDQY-FNKPORJMSA-N |
| XLogP | 13.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.11 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|