C54H52O4 — CID 139175762
(2E,3R)-3-[4-(4-hexylphenyl)phenyl]-2-[(1S)-1-[4-(4-hexylphenyl)phenyl]-1-hydroxy-3-oxoinden-2-ylidene]-3-hydroxyinden-1-one (PubChem CID 139175762) has the molecular formula C54H52O4 and a molecular weight of 765.01 g/mol. Its IUPAC name is (2E,3R)-3-[4-(4-hexylphenyl)phenyl]-2-[(1S)-1-[4-(4-hexylphenyl)phenyl]-1-hydroxy-3-oxoinden-2-ylidene]-3-hydroxyinden-1-one.
| Compound Name | (2E,3R)-3-[4-(4-hexylphenyl)phenyl]-2-[(1S)-1-[4-(4-hexylphenyl)phenyl]-1-hydroxy-3-oxoinden-2-ylidene]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 139175762 |
| Molecular Formula | C54H52O4 |
| Molecular Weight | 765.01 g/mol |
| Exact Mass | 764.39 |
| IUPAC Name | (2E,3R)-3-[4-(4-hexylphenyl)phenyl]-2-[(1S)-1-[4-(4-hexylphenyl)phenyl]-1-hydroxy-3-oxoinden-2-ylidene]-3-hydroxyinden-1-one |
| SMILES | CCCCCCc1ccc(-c2ccc([C@]3(O)/C(=C4\C(=O)c5ccccc5[C@@]4(O)c4ccc(-c5ccc(CCCCCC)cc5)cc4)C(=O)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C54H52O4/c1-3-5-7-9-15-37-21-25-39(26-22-37)41-29-33-43(34-30-41)53(57)47-19-13-11-17-45(47)51(55)49(53)50-52(56)46-18-12-14-20-48(46)54(50,58)44-35-31-42(32-36-44)40-27-23-38(24-28-40)16-10-8-6-4-2/h11-14,17-36,57-58H,3-10,15-16H2,1-2H3/b50-49+/t53-,54+ |
| InChIKey | HQPMSYNSVGNGQL-MAMNBJHESA-N |
| XLogP | 12.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.01 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|