About 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol
9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol (PubChem CID 59010585) has the molecular formula C47H46O2
and a molecular weight of 642.88 g/mol. Its IUPAC name is 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol.
Molecular Properties
| Compound Name | 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol |
| PubChem CID | 59010585 |
| Molecular Formula | C47H46O2 |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol |
| SMILES | CCCCc1ccc(-c2ccc(C3(O)c4ccccc4C(O)(c4ccc(-c5ccc(CCCC)cc5)cc4)c4cc(C)ccc43)cc2)cc1 |
| InChI | InChI=1S/C47H46O2/c1-4-6-10-34-15-19-36(20-16-34)38-23-27-40(28-24-38)46(48)42-12-8-9-13-43(42)47(49,45-32-33(3)14-31-44(45)46)41-29-25-39(26-30-41)37-21-17-35(18-22-37)11-7-5-2/h8-9,12-32,48-49H,4-7,10-11H2,1-3H3 |
| InChIKey | ZJXPUBDWBPBPPV-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol?
The IUPAC name of 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol (CID 59010585) is 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol.
What is the SMILES notation for 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol?
The canonical SMILES for 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol is CCCCc1ccc(-c2ccc(C3(O)c4ccccc4C(O)(c4ccc(-c5ccc(CCCC)cc5)cc4)c4cc(C)ccc43)cc2)cc1.
What is the InChIKey of 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol?
The InChIKey is ZJXPUBDWBPBPPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H46O2/c1-4-6-10-34-15-19-36(20-16-34)38-23-27-40(28-24-38)46(48)42-12-8-9-13-43(42)47(49,45-32-33(3)14-31-44(45)46)41-29-25-39(26-30-41)37-21-17-35(18-22-37)11-7-5-2/h8-9,12-32,48-49H,4-7,10-11H2,1-3H3.
What are the key properties of 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol?
9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol has a molecular weight of 642.88 g/mol, XLogP of 10.90, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-bis[4-(4-butylphenyl)phenyl]-2-methylanthracene-9,10-diol is sourced from PubChem (CID 59010585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).