C49H50 — CID 123568014
9,9-bis[4-(4-butylphenyl)phenyl]-2,3,6,7-tetramethylfluorene (PubChem CID 123568014) has the molecular formula C49H50 and a molecular weight of 638.94 g/mol. Its IUPAC name is 9,9-bis[4-(4-butylphenyl)phenyl]-2,3,6,7-tetramethylfluorene.
| Compound Name | 9,9-bis[4-(4-butylphenyl)phenyl]-2,3,6,7-tetramethylfluorene |
|---|---|
| PubChem CID | 123568014 |
| Molecular Formula | C49H50 |
| Molecular Weight | 638.94 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | 9,9-bis[4-(4-butylphenyl)phenyl]-2,3,6,7-tetramethylfluorene |
| SMILES | CCCCc1ccc(-c2ccc(C3(c4ccc(-c5ccc(CCCC)cc5)cc4)c4cc(C)c(C)cc4-c4cc(C)c(C)cc43)cc2)cc1 |
| InChI | InChI=1S/C49H50/c1-7-9-11-37-13-17-39(18-14-37)41-21-25-43(26-22-41)49(44-27-23-42(24-28-44)40-19-15-38(16-20-40)12-10-8-2)47-31-35(5)33(3)29-45(47)46-30-34(4)36(6)32-48(46)49/h13-32H,7-12H2,1-6H3 |
| InChIKey | JAVGTNLMOZHSFM-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.94 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |