C17H21O+ — CID 101036687
4-(4-butylphenyl)-2,6-dimethylpyrylium (PubChem CID 101036687) has the molecular formula C17H21O+ and a molecular weight of 241.35 g/mol. Its IUPAC name is 4-(4-butylphenyl)-2,6-dimethylpyrylium.
| Compound Name | 4-(4-butylphenyl)-2,6-dimethylpyrylium |
|---|---|
| PubChem CID | 101036687 |
| Molecular Formula | C17H21O+ |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-(4-butylphenyl)-2,6-dimethylpyrylium |
| SMILES | CCCCc1ccc(-c2cc(C)[o+]c(C)c2)cc1 |
| InChI | InChI=1S/C17H21O/c1-4-5-6-15-7-9-16(10-8-15)17-11-13(2)18-14(3)12-17/h7-12H,4-6H2,1-3H3/q+1 |
| InChIKey | VKTALUQCWUKCGA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|