C56H59N3 — CID 58412099
2,4-bis(4-tert-butylphenyl)-6-[4-[9-(4-hexylphenyl)-2,7-dimethylfluoren-9-yl]phenyl]-1,3,5-triazine (PubChem CID 58412099) has the molecular formula C56H59N3 and a molecular weight of 774.11 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[4-[9-(4-hexylphenyl)-2,7-dimethylfluoren-9-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[4-[9-(4-hexylphenyl)-2,7-dimethylfluoren-9-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58412099 |
| Molecular Formula | C56H59N3 |
| Molecular Weight | 774.11 g/mol |
| Exact Mass | 773.47 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[4-[9-(4-hexylphenyl)-2,7-dimethylfluoren-9-yl]phenyl]-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(C2(c3ccc(-c4nc(-c5ccc(C(C)(C)C)cc5)nc(-c5ccc(C(C)(C)C)cc5)n4)cc3)c3cc(C)ccc3-c3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C56H59N3/c1-10-11-12-13-14-39-17-25-45(26-18-39)56(49-35-37(2)15-33-47(49)48-34-16-38(3)36-50(48)56)46-31-23-42(24-32-46)53-58-51(40-19-27-43(28-20-40)54(4,5)6)57-52(59-53)41-21-29-44(30-22-41)55(7,8)9/h15-36H,10-14H2,1-9H3 |
| InChIKey | HBTZUXUPXOLHIH-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.11 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|