C63H74N4 — CID 140941428
2-[6-[9-(4-hexylphenyl)-7,9-dimethylfluoren-2-yl]-3-pyridinyl]-4,6-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 140941428) has the molecular formula C63H74N4 and a molecular weight of 887.31 g/mol. Its IUPAC name is 2-[6-[9-(4-hexylphenyl)-7,9-dimethylfluoren-2-yl]-3-pyridinyl]-4,6-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[6-[9-(4-hexylphenyl)-7,9-dimethylfluoren-2-yl]-3-pyridinyl]-4,6-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140941428 |
| Molecular Formula | C63H74N4 |
| Molecular Weight | 887.31 g/mol |
| Exact Mass | 886.59 |
| IUPAC Name | 2-[6-[9-(4-hexylphenyl)-7,9-dimethylfluoren-2-yl]-3-pyridinyl]-4,6-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(C2(C)c3cc(C)ccc3-c3ccc(-c4ccc(-c5nc(-c6ccc(C(C)(C)CC(C)(C)C)cc6)nc(-c6ccc(C(C)(C)CC(C)(C)C)cc6)n5)cn4)cc32)cc1 |
| InChI | InChI=1S/C63H74N4/c1-14-15-16-17-18-43-20-28-50(29-21-43)63(13)53-37-42(2)19-34-51(53)52-35-26-46(38-54(52)63)55-36-27-47(39-64-55)58-66-56(44-22-30-48(31-23-44)61(9,10)40-59(3,4)5)65-57(67-58)45-24-32-49(33-25-45)62(11,12)41-60(6,7)8/h19-39H,14-18,40-41H2,1-13H3 |
| InChIKey | VFWSHLKKUMBVEA-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.31 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|