C73H91N3S2 — CID 58078201
2,4-bis(tert-butylsulfanyl)-6-[4-[9-(4-hexylphenyl)-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]phenyl]-1,3,5-triazine (PubChem CID 58078201) has the molecular formula C73H91N3S2 and a molecular weight of 1074.69 g/mol. Its IUPAC name is 2,4-bis(tert-butylsulfanyl)-6-[4-[9-(4-hexylphenyl)-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(tert-butylsulfanyl)-6-[4-[9-(4-hexylphenyl)-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58078201 |
| Molecular Formula | C73H91N3S2 |
| Molecular Weight | 1074.69 g/mol |
| Exact Mass | 1073.67 |
| IUPAC Name | 2,4-bis(tert-butylsulfanyl)-6-[4-[9-(4-hexylphenyl)-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]phenyl]-1,3,5-triazine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc4c(c3)C(c3ccc(CCCCCC)cc3)(c3ccc(-c5nc(SC(C)(C)C)nc(SC(C)(C)C)n5)cc3)c3cc(C)ccc3-4)cc21 |
| InChI | InChI=1S/C73H91N3S2/c1-12-15-18-21-23-26-45-72(46-27-24-22-19-16-13-2)63-47-51(4)29-41-59(63)60-43-35-55(49-64(60)72)56-36-44-62-61-42-30-52(5)48-65(61)73(66(62)50-56,57-37-31-53(32-38-57)28-25-20-17-14-3)58-39-33-54(34-40-58)67-74-68(77-70(6,7)8)76-69(75-67)78-71(9,10)11/h29-44,47-50H,12-28,45-46H2,1-11H3 |
| InChIKey | MPYGDHKURXRXLE-UHFFFAOYSA-N |
| XLogP | 21.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.69 |
| LogP ≤ 5 | 21.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|