C41H60 — CID 140777730
2-hexyl-5-methyl-1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene (PubChem CID 140777730) has the molecular formula C41H60 and a molecular weight of 552.93 g/mol. Its IUPAC name is 2-hexyl-5-methyl-1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene.
| Compound Name | 2-hexyl-5-methyl-1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene |
|---|---|
| PubChem CID | 140777730 |
| Molecular Formula | C41H60 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.47 |
| IUPAC Name | 2-hexyl-5-methyl-1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene |
| SMILES | CCCCCCc1c(-c2ccc(C(C)(C)CC(C)(C)C)cc2)cc(C)cc1-c1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C41H60/c1-13-14-15-16-17-35-36(31-18-22-33(23-19-31)40(9,10)28-38(3,4)5)26-30(2)27-37(35)32-20-24-34(25-21-32)41(11,12)29-39(6,7)8/h18-27H,13-17,28-29H2,1-12H3 |
| InChIKey | SCBLYIXRMSHMDY-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|