C20H27N — CID 123485897
4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline (PubChem CID 123485897) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline.
| Compound Name | 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 123485897 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C20H27N/c1-19(2,3)14-20(4,5)17-10-6-15(7-11-17)16-8-12-18(21)13-9-16/h6-13H,14,21H2,1-5H3 |
| InChIKey | ZBOPZBUYUTUGDP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|