C17H25N3 — CID 117431686
4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1H-pyrazol-5-amine (PubChem CID 117431686) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117431686 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1H-pyrazol-5-amine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(-c2cn[nH]c2N)cc1 |
| InChI | InChI=1S/C17H25N3/c1-16(2,3)11-17(4,5)13-8-6-12(7-9-13)14-10-19-20-15(14)18/h6-10H,11H2,1-5H3,(H3,18,19,20) |
| InChIKey | GKGGXYRMHPWDNB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |