C15H15FN4S — CID 163998023
4-[4-[4-(2-fluoropropan-2-yl)phenyl]-1,3-thiazol-2-yl]-1H-pyrazol-5-amine (PubChem CID 163998023) has the molecular formula C15H15FN4S and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[4-[4-(2-fluoropropan-2-yl)phenyl]-1,3-thiazol-2-yl]-1H-pyrazol-5-amine.
| Compound Name | 4-[4-[4-(2-fluoropropan-2-yl)phenyl]-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 163998023 |
| Molecular Formula | C15H15FN4S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-[4-[4-(2-fluoropropan-2-yl)phenyl]-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
| SMILES | CC(C)(F)c1ccc(-c2csc(-c3cn[nH]c3N)n2)cc1 |
| InChI | InChI=1S/C15H15FN4S/c1-15(2,16)10-5-3-9(4-6-10)12-8-21-14(19-12)11-7-18-20-13(11)17/h3-8H,1-2H3,(H3,17,18,20) |
| InChIKey | UGKQHEAZEHDAFR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|