C15H11ClN2S — CID 12621900
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]aniline (PubChem CID 12621900) has the molecular formula C15H11ClN2S and a molecular weight of 286.79 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]aniline.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 12621900 |
| Molecular Formula | C15H11ClN2S |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]aniline |
| SMILES | Nc1ccccc1-c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C15H11ClN2S/c16-11-7-5-10(6-8-11)14-9-19-15(18-14)12-3-1-2-4-13(12)17/h1-9H,17H2 |
| InChIKey | JFYHGKDQAVKIBO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|