C15H9F3N2S — CID 107935455
4-[2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]aniline (PubChem CID 107935455) has the molecular formula C15H9F3N2S and a molecular weight of 306.31 g/mol. Its IUPAC name is 4-[2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]aniline.
| Compound Name | 4-[2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 107935455 |
| Molecular Formula | C15H9F3N2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-[2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]aniline |
| SMILES | Nc1ccc(-c2csc(-c3ccc(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C15H9F3N2S/c16-11-6-5-10(13(17)14(11)18)15-20-12(7-21-15)8-1-3-9(19)4-2-8/h1-7H,19H2 |
| InChIKey | RGWYTWQQOJJXQQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|