C15H10ClNOS — CID 1473815
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]phenol (PubChem CID 1473815) has the molecular formula C15H10ClNOS and a molecular weight of 287.77 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 1473815 |
| Molecular Formula | C15H10ClNOS |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C15H10ClNOS/c16-12-5-1-10(2-6-12)14-9-19-15(17-14)11-3-7-13(18)8-4-11/h1-9,18H |
| InChIKey | PZKMTILXYHGUCY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |