C13H8BrNO2S — CID 136907983
4-[4-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]phenol (PubChem CID 136907983) has the molecular formula C13H8BrNO2S and a molecular weight of 322.18 g/mol. Its IUPAC name is 4-[4-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 4-[4-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 136907983 |
| Molecular Formula | C13H8BrNO2S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 4-[4-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc(-c3ccc(Br)o3)cs2)cc1 |
| InChI | InChI=1S/C13H8BrNO2S/c14-12-6-5-11(17-12)10-7-18-13(15-10)8-1-3-9(16)4-2-8/h1-7,16H |
| InChIKey | DJMCIADSQZVEKS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |