C13H10N2OS2 — CID 136969519
4-[4-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]phenol (PubChem CID 136969519) has the molecular formula C13H10N2OS2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-[4-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 4-[4-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 136969519 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-[4-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]phenol |
| SMILES | Cc1nc(-c2csc(-c3ccc(O)cc3)n2)cs1 |
| InChI | InChI=1S/C13H10N2OS2/c1-8-14-11(6-17-8)12-7-18-13(15-12)9-2-4-10(16)5-3-9/h2-7,16H,1H3 |
| InChIKey | PKWNIXLYHVLNHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |