C18H17NS — CID 174868608
2-methyl-4-[4-(2-phenylethyl)phenyl]-1,3-thiazole (PubChem CID 174868608) has the molecular formula C18H17NS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-methyl-4-[4-(2-phenylethyl)phenyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[4-(2-phenylethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 174868608 |
| Molecular Formula | C18H17NS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-methyl-4-[4-(2-phenylethyl)phenyl]-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc(CCc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C18H17NS/c1-14-19-18(13-20-14)17-11-9-16(10-12-17)8-7-15-5-3-2-4-6-15/h2-6,9-13H,7-8H2,1H3 |
| InChIKey | GYPWOBJAJMHPKO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |