C21H26INS — CID 54249717
ethane;4-[4-(2-iodoethyl)phenyl]-2-phenyl-1,3-thiazole (PubChem CID 54249717) has the molecular formula C21H26INS and a molecular weight of 451.42 g/mol. Its IUPAC name is ethane;4-[4-(2-iodoethyl)phenyl]-2-phenyl-1,3-thiazole.
| Compound Name | ethane;4-[4-(2-iodoethyl)phenyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 54249717 |
| Molecular Formula | C21H26INS |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | ethane;4-[4-(2-iodoethyl)phenyl]-2-phenyl-1,3-thiazole |
| SMILES | CC.CC.ICCc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H14INS.2C2H6/c18-11-10-13-6-8-14(9-7-13)16-12-20-17(19-16)15-4-2-1-3-5-15;2*1-2/h1-9,12H,10-11H2;2*1-2H3 |
| InChIKey | QVWVJMUHIVCTTH-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|