C20H17NSV — CID 20679149
ethyne;2-phenyl-4-(4-propylphenyl)-1,3-thiazole;vanadium(2+) (PubChem CID 20679149) has the molecular formula C20H17NSV and a molecular weight of 354.37 g/mol. Its IUPAC name is ethyne;2-phenyl-4-(4-propylphenyl)-1,3-thiazole;vanadium(2+).
| Compound Name | ethyne;2-phenyl-4-(4-propylphenyl)-1,3-thiazole;vanadium(2+) |
|---|---|
| PubChem CID | 20679149 |
| Molecular Formula | C20H17NSV |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | ethyne;2-phenyl-4-(4-propylphenyl)-1,3-thiazole;vanadium(2+) |
| SMILES | [C-]#C.[CH2-]CCc1ccc(-c2csc(-c3ccccc3)n2)cc1.[V+2] |
| InChI | InChI=1S/C18H16NS.C2H.V/c1-2-6-14-9-11-15(12-10-14)17-13-20-18(19-17)16-7-4-3-5-8-16;1-2;/h3-5,7-13H,1-2,6H2;1H;/q2*-1;+2 |
| InChIKey | NRUOGSXSSVTTTG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|