C12H14N2S — CID 105473201
2-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]ethanamine (PubChem CID 105473201) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]ethanamine.
| Compound Name | 2-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 105473201 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]ethanamine |
| SMILES | Cc1nc(-c2cccc(CCN)c2)cs1 |
| InChI | InChI=1S/C12H14N2S/c1-9-14-12(8-15-9)11-4-2-3-10(7-11)5-6-13/h2-4,7-8H,5-6,13H2,1H3 |
| InChIKey | CVCROJNLVQLHPF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |