C15H23NS — CID 142374611
ethane;2-methyl-4-(3-methylphenyl)-1,3-thiazole (PubChem CID 142374611) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is ethane;2-methyl-4-(3-methylphenyl)-1,3-thiazole.
| Compound Name | ethane;2-methyl-4-(3-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 142374611 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | ethane;2-methyl-4-(3-methylphenyl)-1,3-thiazole |
| SMILES | CC.CC.Cc1cccc(-c2csc(C)n2)c1 |
| InChI | InChI=1S/C11H11NS.2C2H6/c1-8-4-3-5-10(6-8)11-7-13-9(2)12-11;2*1-2/h3-7H,1-2H3;2*1-2H3 |
| InChIKey | DKIJYXZLUDJARP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |