C16H12BrNS — CID 78913074
4-(3-bromophenyl)-2-(3-methylphenyl)-1,3-thiazole (PubChem CID 78913074) has the molecular formula C16H12BrNS and a molecular weight of 330.25 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-(3-methylphenyl)-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-(3-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 78913074 |
| Molecular Formula | C16H12BrNS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 4-(3-bromophenyl)-2-(3-methylphenyl)-1,3-thiazole |
| SMILES | Cc1cccc(-c2nc(-c3cccc(Br)c3)cs2)c1 |
| InChI | InChI=1S/C16H12BrNS/c1-11-4-2-6-13(8-11)16-18-15(10-19-16)12-5-3-7-14(17)9-12/h2-10H,1H3 |
| InChIKey | IGPBDHPAXQCJBX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |