C14H10BrNOS — CID 113453495
4-(3-bromophenyl)-2-(2-methylfuran-3-yl)-1,3-thiazole (PubChem CID 113453495) has the molecular formula C14H10BrNOS and a molecular weight of 320.21 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-(2-methylfuran-3-yl)-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-(2-methylfuran-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 113453495 |
| Molecular Formula | C14H10BrNOS |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 4-(3-bromophenyl)-2-(2-methylfuran-3-yl)-1,3-thiazole |
| SMILES | Cc1occc1-c1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C14H10BrNOS/c1-9-12(5-6-17-9)14-16-13(8-18-14)10-3-2-4-11(15)7-10/h2-8H,1H3 |
| InChIKey | MADIBXGHVFSCQH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |