C13H9BrN2S — CID 78907588
2-(3-bromophenyl)-4-(1H-pyrrol-2-yl)-1,3-thiazole (PubChem CID 78907588) has the molecular formula C13H9BrN2S and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-(1H-pyrrol-2-yl)-1,3-thiazole.
| Compound Name | 2-(3-bromophenyl)-4-(1H-pyrrol-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 78907588 |
| Molecular Formula | C13H9BrN2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 2-(3-bromophenyl)-4-(1H-pyrrol-2-yl)-1,3-thiazole |
| SMILES | Brc1cccc(-c2nc(-c3ccc[nH]3)cs2)c1 |
| InChI | InChI=1S/C13H9BrN2S/c14-10-4-1-3-9(7-10)13-16-12(8-17-13)11-5-2-6-15-11/h1-8,15H |
| InChIKey | NPNUNHBDVDYMFY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |