C13H7BrN2O3S — CID 70529379
3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-4-hydroxypyrrole-2,5-dione (PubChem CID 70529379) has the molecular formula C13H7BrN2O3S and a molecular weight of 351.18 g/mol. Its IUPAC name is 3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-4-hydroxypyrrole-2,5-dione.
| Compound Name | 3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 70529379 |
| Molecular Formula | C13H7BrN2O3S |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-4-hydroxypyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2csc(-c3cccc(Br)c3)n2)=C1O |
| InChI | InChI=1S/C13H7BrN2O3S/c14-7-3-1-2-6(4-7)13-15-8(5-20-13)9-10(17)12(19)16-11(9)18/h1-5H,(H2,16,17,18,19) |
| InChIKey | YSTFUHAHFXDEOW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|