C13H7Br2NS2 — CID 79838979
4-(3-bromophenyl)-2-(5-bromothiophen-2-yl)-1,3-thiazole (PubChem CID 79838979) has the molecular formula C13H7Br2NS2 and a molecular weight of 401.15 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-(5-bromothiophen-2-yl)-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-(5-bromothiophen-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 79838979 |
| Molecular Formula | C13H7Br2NS2 |
| Molecular Weight | 401.15 g/mol |
| Exact Mass | 398.84 |
| IUPAC Name | 4-(3-bromophenyl)-2-(5-bromothiophen-2-yl)-1,3-thiazole |
| SMILES | Brc1cccc(-c2csc(-c3ccc(Br)s3)n2)c1 |
| InChI | InChI=1S/C13H7Br2NS2/c14-9-3-1-2-8(6-9)10-7-17-13(16-10)11-4-5-12(15)18-11/h1-7H |
| InChIKey | OYJPYSMKOJORHE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.15 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |