[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride

C11H13ClN2S — CID 10776459

IUPAC[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride
SMILESCc1nc(-c2cccc(C[NH3+])c2)cs1.[Cl-]
InChIInChI=1S/C11H12N2S.ClH/c1-8-13-11(7-14-8)10-4-2-3-9(5-10)6-12;/h2-5,7H,6,12H2,1H3;1H
InChIKeyPKFCESWBYVZESK-UHFFFAOYSA-N
MW240.76 g/mol
LogP-1.14
Rot. Bonds2

About [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride

[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride (PubChem CID 10776459) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride.

Molecular Properties

Compound Name[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride
PubChem CID10776459
Molecular FormulaC11H13ClN2S
Molecular Weight240.76 g/mol
Exact Mass240.05
IUPAC Name[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride
SMILESCc1nc(-c2cccc(C[NH3+])c2)cs1.[Cl-]
InChIInChI=1S/C11H12N2S.ClH/c1-8-13-11(7-14-8)10-4-2-3-9(5-10)6-12;/h2-5,7H,6,12H2,1H3;1H
InChIKeyPKFCESWBYVZESK-UHFFFAOYSA-N
XLogP-1.14
TPSA40.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.76
LogP ≤ 5-1.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride?
The IUPAC name of [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride (CID 10776459) is [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride.
What is the SMILES notation for [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride?
The canonical SMILES for [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride is Cc1nc(-c2cccc(C[NH3+])c2)cs1.[Cl-].
What is the InChIKey of [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride?
The InChIKey is PKFCESWBYVZESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S.ClH/c1-8-13-11(7-14-8)10-4-2-3-9(5-10)6-12;/h2-5,7H,6,12H2,1H3;1H.
What are the key properties of [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride?
[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride has a molecular weight of 240.76 g/mol, XLogP of -1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride is sourced from PubChem (CID 10776459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).