C11H13ClN2S — CID 10776459
[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride (PubChem CID 10776459) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride.
| Compound Name | [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride |
|---|---|
| PubChem CID | 10776459 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylazanium chloride |
| SMILES | Cc1nc(-c2cccc(C[NH3+])c2)cs1.[Cl-] |
| InChI | InChI=1S/C11H12N2S.ClH/c1-8-13-11(7-14-8)10-4-2-3-9(5-10)6-12;/h2-5,7H,6,12H2,1H3;1H |
| InChIKey | PKFCESWBYVZESK-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |