C14H18N2O2S — CID 55233873
N-(2,2-dimethoxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 55233873) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)aniline.
| Compound Name | N-(2,2-dimethoxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 55233873 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | COC(CNc1cccc(-c2csc(C)n2)c1)OC |
| InChI | InChI=1S/C14H18N2O2S/c1-10-16-13(9-19-10)11-5-4-6-12(7-11)15-8-14(17-2)18-3/h4-7,9,14-15H,8H2,1-3H3 |
| InChIKey | JWNDXLNSFSVOGO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|