C15H18N2OS — CID 82833997
3-(2-methyl-1,3-thiazol-4-yl)-N-(oxolan-2-ylmethyl)aniline (PubChem CID 82833997) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-N-(oxolan-2-ylmethyl)aniline.
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)-N-(oxolan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 82833997 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)-N-(oxolan-2-ylmethyl)aniline |
| SMILES | Cc1nc(-c2cccc(NCC3CCCO3)c2)cs1 |
| InChI | InChI=1S/C15H18N2OS/c1-11-17-15(10-19-11)12-4-2-5-13(8-12)16-9-14-6-3-7-18-14/h2,4-5,8,10,14,16H,3,6-7,9H2,1H3 |
| InChIKey | SVGWOGXUQQDDJU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |