C17H24N2S — CID 63945706
N-heptan-3-yl-3-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 63945706) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N-heptan-3-yl-3-(2-methyl-1,3-thiazol-4-yl)aniline.
| Compound Name | N-heptan-3-yl-3-(2-methyl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 63945706 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-heptan-3-yl-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | CCCCC(CC)Nc1cccc(-c2csc(C)n2)c1 |
| InChI | InChI=1S/C17H24N2S/c1-4-6-9-15(5-2)19-16-10-7-8-14(11-16)17-12-20-13(3)18-17/h7-8,10-12,15,19H,4-6,9H2,1-3H3 |
| InChIKey | XRNXTMXEURTNMX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |