C15H19N3S2 — CID 100560500
1-[(2R)-butan-2-yl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea (PubChem CID 100560500) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100560500 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea |
| SMILES | CC[C@@H](C)NC(=S)Nc1cccc(-c2csc(C)n2)c1 |
| InChI | InChI=1S/C15H19N3S2/c1-4-10(2)16-15(19)18-13-7-5-6-12(8-13)14-9-20-11(3)17-14/h5-10H,4H2,1-3H3,(H2,16,18,19)/t10-/m1/s1 |
| InChIKey | DHUFJTWGAWQFBK-SNVBAGLBSA-N |
| XLogP | 4.20 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|