C21H23N3O2S2 — CID 100560652
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea (PubChem CID 100560652) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100560652 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2cccc(-c3csc(C)n3)c2)cc1OC |
| InChI | InChI=1S/C21H23N3O2S2/c1-14-23-18(13-28-14)16-5-4-6-17(12-16)24-21(27)22-10-9-15-7-8-19(25-2)20(11-15)26-3/h4-8,11-13H,9-10H2,1-3H3,(H2,22,24,27) |
| InChIKey | KHZBSDBOYFHPJW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|