C9H9N3S — CID 28865398
4-(2-aminophenyl)-1,3-thiazol-2-amine (PubChem CID 28865398) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 4-(2-aminophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-aminophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 28865398 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 4-(2-aminophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2N)cs1 |
| InChI | InChI=1S/C9H9N3S/c10-7-4-2-1-3-6(7)8-5-13-9(11)12-8/h1-5H,10H2,(H2,11,12) |
| InChIKey | SUSHSIYRYCQMFL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|