About 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline
2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline (PubChem CID 79197472) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline.
Molecular Properties
| Compound Name | 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline |
| PubChem CID | 79197472 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline |
| SMILES | COC(C)(C)c1nc(-c2ccccc2N)cs1 |
| InChI | InChI=1S/C13H16N2OS/c1-13(2,16-3)12-15-11(8-17-12)9-6-4-5-7-10(9)14/h4-8H,14H2,1-3H3 |
| InChIKey | WTKMAHTZMYMDDV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline?
The IUPAC name of 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline (CID 79197472) is 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline.
What is the SMILES notation for 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline?
The canonical SMILES for 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline is COC(C)(C)c1nc(-c2ccccc2N)cs1.
What is the InChIKey of 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline?
The InChIKey is WTKMAHTZMYMDDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-13(2,16-3)12-15-11(8-17-12)9-6-4-5-7-10(9)14/h4-8H,14H2,1-3H3.
What are the key properties of 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline?
2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline has a molecular weight of 248.35 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxypropan-2-yl)-1,3-thiazol-4-yl]aniline is sourced from PubChem (CID 79197472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).