About 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline
2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline (PubChem CID 62331131) has the molecular formula C17H16N2S
and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline.
Molecular Properties
| Compound Name | 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline |
| PubChem CID | 62331131 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline |
| SMILES | Cc1ccc(Cc2nc(-c3ccccc3N)cs2)cc1 |
| InChI | InChI=1S/C17H16N2S/c1-12-6-8-13(9-7-12)10-17-19-16(11-20-17)14-4-2-3-5-15(14)18/h2-9,11H,10,18H2,1H3 |
| InChIKey | IIKNPEHKLBBJOF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline?
The IUPAC name of 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline (CID 62331131) is 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline.
What is the SMILES notation for 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline?
The canonical SMILES for 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline is Cc1ccc(Cc2nc(-c3ccccc3N)cs2)cc1.
What is the InChIKey of 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline?
The InChIKey is IIKNPEHKLBBJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2S/c1-12-6-8-13(9-7-12)10-17-19-16(11-20-17)14-4-2-3-5-15(14)18/h2-9,11H,10,18H2,1H3.
What are the key properties of 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline?
2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline has a molecular weight of 280.40 g/mol, XLogP of 4.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-methylphenyl)methyl]-1,3-thiazol-4-yl]aniline is sourced from PubChem (CID 62331131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).