C10H8N2O2S — CID 1409773
2-(2-amino-1,3-thiazol-4-yl)benzoic acid (PubChem CID 1409773) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)benzoic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 1409773 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)benzoic acid |
| SMILES | Nc1nc(-c2ccccc2C(=O)O)cs1 |
| InChI | InChI=1S/C10H8N2O2S/c11-10-12-8(5-15-10)6-3-1-2-4-7(6)9(13)14/h1-5H,(H2,11,12)(H,13,14) |
| InChIKey | DPPLJWSTECTTET-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |