C14H14N4OS — CID 60650136
4-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine (PubChem CID 60650136) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine.
| Compound Name | 4-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 60650136 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
| SMILES | CCOc1ccc(-c2csc(-c3cn[nH]c3N)n2)cc1 |
| InChI | InChI=1S/C14H14N4OS/c1-2-19-10-5-3-9(4-6-10)12-8-20-14(17-12)11-7-16-18-13(11)15/h3-8H,2H2,1H3,(H3,15,16,18) |
| InChIKey | MVMPSPZCGUPZKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|