C14H21NaO — CID 23688526
sodium 4-(2,4,4-trimethylpentan-2-yl)phenolate (PubChem CID 23688526) has the molecular formula C14H21NaO and a molecular weight of 228.31 g/mol. Its IUPAC name is sodium 4-(2,4,4-trimethylpentan-2-yl)phenolate.
| Compound Name | sodium 4-(2,4,4-trimethylpentan-2-yl)phenolate |
|---|---|
| PubChem CID | 23688526 |
| Molecular Formula | C14H21NaO |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | sodium 4-(2,4,4-trimethylpentan-2-yl)phenolate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc([O-])cc1.[Na+] |
| InChI | InChI=1S/C14H22O.Na/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;/h6-9,15H,10H2,1-5H3;/q;+1/p-1 |
| InChIKey | YAHOGQYAIIYWKU-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |