C16H31N — CID 144516441
methanamine;methane;2,4,4-trimethylpentan-2-ylbenzene (PubChem CID 144516441) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is methanamine;methane;2,4,4-trimethylpentan-2-ylbenzene.
| Compound Name | methanamine;methane;2,4,4-trimethylpentan-2-ylbenzene |
|---|---|
| PubChem CID | 144516441 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | methanamine;methane;2,4,4-trimethylpentan-2-ylbenzene |
| SMILES | C.CC(C)(C)CC(C)(C)c1ccccc1.CN |
| InChI | InChI=1S/C14H22.CH5N.CH4/c1-13(2,3)11-14(4,5)12-9-7-6-8-10-12;1-2;/h6-10H,11H2,1-5H3;2H2,1H3;1H4 |
| InChIKey | CRODZXLORHXYDQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |