C34H46 — CID 140720974
1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene (PubChem CID 140720974) has the molecular formula C34H46 and a molecular weight of 454.74 g/mol. Its IUPAC name is 1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene.
| Compound Name | 1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene |
|---|---|
| PubChem CID | 140720974 |
| Molecular Formula | C34H46 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | 1,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(-c2cccc(-c3ccc(C(C)(C)CC(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C34H46/c1-31(2,3)23-33(7,8)29-18-14-25(15-19-29)27-12-11-13-28(22-27)26-16-20-30(21-17-26)34(9,10)24-32(4,5)6/h11-22H,23-24H2,1-10H3 |
| InChIKey | QMHDUYLVSZNINY-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |