C34H48 — CID 144946836
1-(2,4,4-trimethylpentan-2-yl)-4-[3-[4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,5-dien-1-yl]phenyl]benzene (PubChem CID 144946836) has the molecular formula C34H48 and a molecular weight of 456.76 g/mol. Its IUPAC name is 1-(2,4,4-trimethylpentan-2-yl)-4-[3-[4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,5-dien-1-yl]phenyl]benzene.
| Compound Name | 1-(2,4,4-trimethylpentan-2-yl)-4-[3-[4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,5-dien-1-yl]phenyl]benzene |
|---|---|
| PubChem CID | 144946836 |
| Molecular Formula | C34H48 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | 1-(2,4,4-trimethylpentan-2-yl)-4-[3-[4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,5-dien-1-yl]phenyl]benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(-c2cccc(C3=CCC(C(C)(C)CC(C)(C)C)C=C3)c2)cc1 |
| InChI | InChI=1S/C34H48/c1-31(2,3)23-33(7,8)29-18-14-25(15-19-29)27-12-11-13-28(22-27)26-16-20-30(21-17-26)34(9,10)24-32(4,5)6/h11-20,22,30H,21,23-24H2,1-10H3 |
| InChIKey | RSAPZEARZVREBJ-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |