C59H48N6 — CID 163895787
2-[4-[1-ethyl-1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]propyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 163895787) has the molecular formula C59H48N6 and a molecular weight of 841.08 g/mol. Its IUPAC name is 2-[4-[1-ethyl-1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]propyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[1-ethyl-1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]propyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163895787 |
| Molecular Formula | C59H48N6 |
| Molecular Weight | 841.08 g/mol |
| Exact Mass | 840.39 |
| IUPAC Name | 2-[4-[1-ethyl-1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]propyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CCC(CC)(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1)C1C=CC(c2nc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)cc3)n2)=CC1 |
| InChI | InChI=1S/C59H48N6/c1-3-59(4-2,51-37-33-49(34-38-51)57-62-53(45-21-13-7-14-22-45)60-55(64-57)47-29-25-43(26-30-47)41-17-9-5-10-18-41)52-39-35-50(36-40-52)58-63-54(46-23-15-8-16-24-46)61-56(65-58)48-31-27-44(28-32-48)42-19-11-6-12-20-42/h5-39,52H,3-4,40H2,1-2H3 |
| InChIKey | QFLYAXFEBJWHSW-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.08 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |