C28H21ClN2 — CID 146352346
4-(4-chlorocyclohexa-1,5-dien-1-yl)-2-phenyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 146352346) has the molecular formula C28H21ClN2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 4-(4-chlorocyclohexa-1,5-dien-1-yl)-2-phenyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-(4-chlorocyclohexa-1,5-dien-1-yl)-2-phenyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 146352346 |
| Molecular Formula | C28H21ClN2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-(4-chlorocyclohexa-1,5-dien-1-yl)-2-phenyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | ClC1C=CC(c2cc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccccc3)n2)=CC1 |
| InChI | InChI=1S/C28H21ClN2/c29-25-17-15-23(16-18-25)27-19-26(30-28(31-27)24-9-5-2-6-10-24)22-13-11-21(12-14-22)20-7-3-1-4-8-20/h1-17,19,25H,18H2 |
| InChIKey | ZLAZHQLEUNOIIN-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|