C29H44 — CID 143216881
2-(2,4,4-trimethylpentan-2-yl)-5-[4-(2,4,4-trimethylpentan-2-yl)phenyl]cyclohepta-1,3,5-triene (PubChem CID 143216881) has the molecular formula C29H44 and a molecular weight of 392.67 g/mol. Its IUPAC name is 2-(2,4,4-trimethylpentan-2-yl)-5-[4-(2,4,4-trimethylpentan-2-yl)phenyl]cyclohepta-1,3,5-triene.
| Compound Name | 2-(2,4,4-trimethylpentan-2-yl)-5-[4-(2,4,4-trimethylpentan-2-yl)phenyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143216881 |
| Molecular Formula | C29H44 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | 2-(2,4,4-trimethylpentan-2-yl)-5-[4-(2,4,4-trimethylpentan-2-yl)phenyl]cyclohepta-1,3,5-triene |
| SMILES | CC(C)(C)CC(C)(C)C1=CCC=C(c2ccc(C(C)(C)CC(C)(C)C)cc2)C=C1 |
| InChI | InChI=1S/C29H44/c1-26(2,3)20-28(7,8)24-13-11-12-22(14-17-24)23-15-18-25(19-16-23)29(9,10)21-27(4,5)6/h12-19H,11,20-21H2,1-10H3 |
| InChIKey | NDPWCBHCFVCIAL-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |