About 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene
1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene (PubChem CID 19103892) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene |
| PubChem CID | 19103892 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene |
| SMILES | CC(C)(C)c1ccc(C2=CCC=C2)cc1 |
| InChI | InChI=1S/C15H18/c1-15(2,3)14-10-8-13(9-11-14)12-6-4-5-7-12/h4,6-11H,5H2,1-3H3 |
| InChIKey | MMXCTMHJXYYJLG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene?
The IUPAC name of 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene (CID 19103892) is 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene.
What is the SMILES notation for 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene?
The canonical SMILES for 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene is CC(C)(C)c1ccc(C2=CCC=C2)cc1.
What is the InChIKey of 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene?
The InChIKey is MMXCTMHJXYYJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18/c1-15(2,3)14-10-8-13(9-11-14)12-6-4-5-7-12/h4,6-11H,5H2,1-3H3.
What are the key properties of 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene?
1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene has a molecular weight of 198.31 g/mol, XLogP of 4.33, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-cyclopenta-1,4-dien-1-ylbenzene is sourced from PubChem (CID 19103892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).