C16H24O — CID 6455739
acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 6455739) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 6455739 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | C#C.CC(C)(C)CC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H22O.C2H2/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;1-2/h6-9,15H,10H2,1-5H3;1-2H |
| InChIKey | JIVPFTRBHANEMA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|