About acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol
acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 6455739) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol.
Molecular Properties
| Compound Name | acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol |
| PubChem CID | 6455739 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | C#C.CC(C)(C)CC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H22O.C2H2/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;1-2/h6-9,15H,10H2,1-5H3;1-2H |
| InChIKey | JIVPFTRBHANEMA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol?
The IUPAC name of acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol (CID 6455739) is acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol.
What is the SMILES notation for acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol?
The canonical SMILES for acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol is C#C.CC(C)(C)CC(C)(C)c1ccc(O)cc1.
What is the InChIKey of acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol?
The InChIKey is JIVPFTRBHANEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C2H2/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;1-2/h6-9,15H,10H2,1-5H3;1-2H.
What are the key properties of acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol?
acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol has a molecular weight of 232.37 g/mol, XLogP of 4.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;4-(2,4,4-trimethylpentan-2-yl)phenol is sourced from PubChem (CID 6455739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).