C19H31N — CID 117436802
4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]piperidine (PubChem CID 117436802) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]piperidine.
| Compound Name | 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 117436802 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 4-[4-(2,4,4-trimethylpentan-2-yl)phenyl]piperidine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C19H31N/c1-18(2,3)14-19(4,5)17-8-6-15(7-9-17)16-10-12-20-13-11-16/h6-9,16,20H,10-14H2,1-5H3 |
| InChIKey | IWIJHTCXNPKANS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |