C18H29N — CID 117403115
3-[4-(2,4,4-trimethylpentan-2-yl)phenyl]pyrrolidine (PubChem CID 117403115) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-[4-(2,4,4-trimethylpentan-2-yl)phenyl]pyrrolidine.
| Compound Name | 3-[4-(2,4,4-trimethylpentan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 117403115 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 3-[4-(2,4,4-trimethylpentan-2-yl)phenyl]pyrrolidine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(C2CCNC2)cc1 |
| InChI | InChI=1S/C18H29N/c1-17(2,3)13-18(4,5)16-8-6-14(7-9-16)15-10-11-19-12-15/h6-9,15,19H,10-13H2,1-5H3 |
| InChIKey | AGPCDNUJUKGBEG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |