About ethane;3-phenylpyrrolidine
ethane;3-phenylpyrrolidine (PubChem CID 91032726) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;3-phenylpyrrolidine.
Molecular Properties
| Compound Name | ethane;3-phenylpyrrolidine |
| PubChem CID | 91032726 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;3-phenylpyrrolidine |
| SMILES | CC.c1ccc(C2CCNC2)cc1 |
| InChI | InChI=1S/C10H13N.C2H6/c1-2-4-9(5-3-1)10-6-7-11-8-10;1-2/h1-5,10-11H,6-8H2;1-2H3 |
| InChIKey | JWHIHCIQIICJQJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-phenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-phenylpyrrolidine?
The IUPAC name of ethane;3-phenylpyrrolidine (CID 91032726) is ethane;3-phenylpyrrolidine.
What is the SMILES notation for ethane;3-phenylpyrrolidine?
The canonical SMILES for ethane;3-phenylpyrrolidine is CC.c1ccc(C2CCNC2)cc1.
What is the InChIKey of ethane;3-phenylpyrrolidine?
The InChIKey is JWHIHCIQIICJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C2H6/c1-2-4-9(5-3-1)10-6-7-11-8-10;1-2/h1-5,10-11H,6-8H2;1-2H3.
What are the key properties of ethane;3-phenylpyrrolidine?
ethane;3-phenylpyrrolidine has a molecular weight of 177.29 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-phenylpyrrolidine is sourced from PubChem (CID 91032726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).